C17H27N6O2+ — CID 73393967
3,9-dimethyl-7-(3-methylbutyl)-1-propan-2-yl-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione (PubChem CID 73393967) has the molecular formula C17H27N6O2+ and a molecular weight of 347.44 g/mol. Its IUPAC name is 3,9-dimethyl-7-(3-methylbutyl)-1-propan-2-yl-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione.
| Compound Name | 3,9-dimethyl-7-(3-methylbutyl)-1-propan-2-yl-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione |
|---|---|
| PubChem CID | 73393967 |
| Molecular Formula | C17H27N6O2+ |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | 3,9-dimethyl-7-(3-methylbutyl)-1-propan-2-yl-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione |
| SMILES | CC1=NN(C(C)C)C2=[N+](C1)C1C(=O)N(CCC(C)C)C(=O)N(C)C1=N2 |
| InChI | InChI=1S/C17H27N6O2/c1-10(2)7-8-21-15(24)13-14(20(6)17(21)25)18-16-22(13)9-12(5)19-23(16)11(3)4/h10-11,13H,7-9H2,1-6H3/q+1 |
| InChIKey | KTPXXIWTESKKHY-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 71.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|