C17H17N3O3S — CID 733980
N-(4-morpholin-4-ylphenyl)-1,1-dioxo-1,2-benzothiazol-3-amine (PubChem CID 733980) has the molecular formula C17H17N3O3S and a molecular weight of 343.41 g/mol. Its IUPAC name is N-(4-morpholin-4-ylphenyl)-1,1-dioxo-1,2-benzothiazol-3-amine.
| Compound Name | N-(4-morpholin-4-ylphenyl)-1,1-dioxo-1,2-benzothiazol-3-amine |
|---|---|
| PubChem CID | 733980 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | N-(4-morpholin-4-ylphenyl)-1,1-dioxo-1,2-benzothiazol-3-amine |
| SMILES | O=S1(=O)N=C(Nc2ccc(N3CCOCC3)cc2)c2ccccc21 |
| InChI | InChI=1S/C17H17N3O3S/c21-24(22)16-4-2-1-3-15(16)17(19-24)18-13-5-7-14(8-6-13)20-9-11-23-12-10-20/h1-8H,9-12H2,(H,18,19) |
| InChIKey | KQPGCYODOBNXNX-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|