C21H18ClN3O4 — CID 73398021
[[1-amino-3-(4-methylanilino)-3-oxopropylidene]amino] 5-(2-chlorophenyl)furan-2-carboxylate (PubChem CID 73398021) has the molecular formula C21H18ClN3O4 and a molecular weight of 411.85 g/mol. Its IUPAC name is [[1-amino-3-(4-methylanilino)-3-oxopropylidene]amino] 5-(2-chlorophenyl)furan-2-carboxylate.
| Compound Name | [[1-amino-3-(4-methylanilino)-3-oxopropylidene]amino] 5-(2-chlorophenyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 73398021 |
| Molecular Formula | C21H18ClN3O4 |
| Molecular Weight | 411.85 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | [[1-amino-3-(4-methylanilino)-3-oxopropylidene]amino] 5-(2-chlorophenyl)furan-2-carboxylate |
| SMILES | Cc1ccc(NC(=O)CC(N)=NOC(=O)c2ccc(-c3ccccc3Cl)o2)cc1 |
| InChI | InChI=1S/C21H18ClN3O4/c1-13-6-8-14(9-7-13)24-20(26)12-19(23)25-29-21(27)18-11-10-17(28-18)15-4-2-3-5-16(15)22/h2-11H,12H2,1H3,(H2,23,25)(H,24,26) |
| InChIKey | OFGCIOCNKSFRJW-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.85 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|