C11H10BrF3O — CID 73425037
3-[[2-bromo-5-(trifluoromethyl)phenyl]methyl]oxetane (PubChem CID 73425037) has the molecular formula C11H10BrF3O and a molecular weight of 295.10 g/mol. Its IUPAC name is 3-[[2-bromo-5-(trifluoromethyl)phenyl]methyl]oxetane.
| Compound Name | 3-[[2-bromo-5-(trifluoromethyl)phenyl]methyl]oxetane |
|---|---|
| PubChem CID | 73425037 |
| Molecular Formula | C11H10BrF3O |
| Molecular Weight | 295.10 g/mol |
| Exact Mass | 293.99 |
| IUPAC Name | 3-[[2-bromo-5-(trifluoromethyl)phenyl]methyl]oxetane |
| SMILES | FC(F)(F)c1ccc(Br)c(CC2COC2)c1 |
| InChI | InChI=1S/C11H10BrF3O/c12-10-2-1-9(11(13,14)15)4-8(10)3-7-5-16-6-7/h1-2,4,7H,3,5-6H2 |
| InChIKey | UMLSRZLTYRRAPJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.10 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |