C19H23N3O3 — CID 7342683
(3R)-3-(3,4-dimethoxyphenyl)-5-[2-(1H-imidazol-5-yl)ethylimino]cyclohexan-1-one (PubChem CID 7342683) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is (3R)-3-(3,4-dimethoxyphenyl)-5-[2-(1H-imidazol-5-yl)ethylimino]cyclohexan-1-one.
| Compound Name | (3R)-3-(3,4-dimethoxyphenyl)-5-[2-(1H-imidazol-5-yl)ethylimino]cyclohexan-1-one |
|---|---|
| PubChem CID | 7342683 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | (3R)-3-(3,4-dimethoxyphenyl)-5-[2-(1H-imidazol-5-yl)ethylimino]cyclohexan-1-one |
| SMILES | COc1ccc([C@H]2CC(=O)C/C(=N\CCc3cnc[nH]3)C2)cc1OC |
| InChI | InChI=1S/C19H23N3O3/c1-24-18-4-3-13(9-19(18)25-2)14-7-16(10-17(23)8-14)21-6-5-15-11-20-12-22-15/h3-4,9,11-12,14H,5-8,10H2,1-2H3,(H,20,22)/b21-16-/t14-/m1/s1 |
| InChIKey | XIAQEFNKHJADLS-VDVBZYJVSA-N |
| XLogP | 2.95 |
| TPSA | 76.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|