C20H27N2O3+ — CID 7343514
benzyl-[3-(3,5-dimethoxyanilino)-3-oxopropyl]-ethylazanium (PubChem CID 7343514) has the molecular formula C20H27N2O3+ and a molecular weight of 343.45 g/mol. Its IUPAC name is benzyl-[3-(3,5-dimethoxyanilino)-3-oxopropyl]-ethylazanium.
| Compound Name | benzyl-[3-(3,5-dimethoxyanilino)-3-oxopropyl]-ethylazanium |
|---|---|
| PubChem CID | 7343514 |
| Molecular Formula | C20H27N2O3+ |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | benzyl-[3-(3,5-dimethoxyanilino)-3-oxopropyl]-ethylazanium |
| SMILES | CC[NH+](CCC(=O)Nc1cc(OC)cc(OC)c1)Cc1ccccc1 |
| InChI | InChI=1S/C20H26N2O3/c1-4-22(15-16-8-6-5-7-9-16)11-10-20(23)21-17-12-18(24-2)14-19(13-17)25-3/h5-9,12-14H,4,10-11,15H2,1-3H3,(H,21,23)/p+1 |
| InChIKey | CSVSFHSGBPJYKL-UHFFFAOYSA-O |
| XLogP | 2.14 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |