C16H27N2O3+ — CID 2171394
butyl-[3-(3,5-dimethoxyanilino)-3-oxopropyl]-methylazanium (PubChem CID 2171394) has the molecular formula C16H27N2O3+ and a molecular weight of 295.40 g/mol. Its IUPAC name is butyl-[3-(3,5-dimethoxyanilino)-3-oxopropyl]-methylazanium.
| Compound Name | butyl-[3-(3,5-dimethoxyanilino)-3-oxopropyl]-methylazanium |
|---|---|
| PubChem CID | 2171394 |
| Molecular Formula | C16H27N2O3+ |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | butyl-[3-(3,5-dimethoxyanilino)-3-oxopropyl]-methylazanium |
| SMILES | CCCC[NH+](C)CCC(=O)Nc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C16H26N2O3/c1-5-6-8-18(2)9-7-16(19)17-13-10-14(20-3)12-15(11-13)21-4/h10-12H,5-9H2,1-4H3,(H,17,19)/p+1 |
| InChIKey | BAEAAVLSUZLUEP-UHFFFAOYSA-O |
| XLogP | 1.35 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |