C18H25N3O5 — CID 7602926
4-(4-acetylpiperazin-1-yl)-N-(3,5-dimethoxyphenyl)-4-oxobutanamide (PubChem CID 7602926) has the molecular formula C18H25N3O5 and a molecular weight of 363.41 g/mol. Its IUPAC name is 4-(4-acetylpiperazin-1-yl)-N-(3,5-dimethoxyphenyl)-4-oxobutanamide.
| Compound Name | 4-(4-acetylpiperazin-1-yl)-N-(3,5-dimethoxyphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 7602926 |
| Molecular Formula | C18H25N3O5 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 4-(4-acetylpiperazin-1-yl)-N-(3,5-dimethoxyphenyl)-4-oxobutanamide |
| SMILES | COc1cc(NC(=O)CCC(=O)N2CCN(C(C)=O)CC2)cc(OC)c1 |
| InChI | InChI=1S/C18H25N3O5/c1-13(22)20-6-8-21(9-7-20)18(24)5-4-17(23)19-14-10-15(25-2)12-16(11-14)26-3/h10-12H,4-9H2,1-3H3,(H,19,23) |
| InChIKey | BYNOJXOYSULCRE-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |