C20H20N2O6S — CID 73450139
2-[3-(3-cyanophenyl)prop-2-enyl-[4-(methoxymethoxy)phenyl]sulfamoyl]acetic acid (PubChem CID 73450139) has the molecular formula C20H20N2O6S and a molecular weight of 416.46 g/mol. Its IUPAC name is 2-[3-(3-cyanophenyl)prop-2-enyl-[4-(methoxymethoxy)phenyl]sulfamoyl]acetic acid.
| Compound Name | 2-[3-(3-cyanophenyl)prop-2-enyl-[4-(methoxymethoxy)phenyl]sulfamoyl]acetic acid |
|---|---|
| PubChem CID | 73450139 |
| Molecular Formula | C20H20N2O6S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 2-[3-(3-cyanophenyl)prop-2-enyl-[4-(methoxymethoxy)phenyl]sulfamoyl]acetic acid |
| SMILES | COCOc1ccc(N(CC=Cc2cccc(C#N)c2)S(=O)(=O)CC(=O)O)cc1 |
| InChI | InChI=1S/C20H20N2O6S/c1-27-15-28-19-9-7-18(8-10-19)22(29(25,26)14-20(23)24)11-3-6-16-4-2-5-17(12-16)13-21/h2-10,12H,11,14-15H2,1H3,(H,23,24) |
| InChIKey | JLQMESLGJUIQNN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 116.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|