C20H22N5O4S+ — CID 73452493
N-(3-acetamidophenyl)-2-[(1,3,6-trimethyl-2,4-dioxo-4aH-pyrido[2,3-d]pyrimidin-1-ium-5-yl)sulfanyl]acetamide (PubChem CID 73452493) has the molecular formula C20H22N5O4S+ and a molecular weight of 428.49 g/mol. Its IUPAC name is N-(3-acetamidophenyl)-2-[(1,3,6-trimethyl-2,4-dioxo-4aH-pyrido[2,3-d]pyrimidin-1-ium-5-yl)sulfanyl]acetamide.
| Compound Name | N-(3-acetamidophenyl)-2-[(1,3,6-trimethyl-2,4-dioxo-4aH-pyrido[2,3-d]pyrimidin-1-ium-5-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 73452493 |
| Molecular Formula | C20H22N5O4S+ |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | N-(3-acetamidophenyl)-2-[(1,3,6-trimethyl-2,4-dioxo-4aH-pyrido[2,3-d]pyrimidin-1-ium-5-yl)sulfanyl]acetamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)CSC2=C(C)C=NC3=[N+](C)C(=O)N(C)C(=O)C23)c1 |
| InChI | InChI=1S/C20H21N5O4S/c1-11-9-21-18-16(19(28)25(4)20(29)24(18)3)17(11)30-10-15(27)23-14-7-5-6-13(8-14)22-12(2)26/h5-9,16H,10H2,1-4H3,(H-,22,23,26,27)/p+1 |
| InChIKey | GQMYKVSVGDOSHP-UHFFFAOYSA-O |
| XLogP | 1.92 |
| TPSA | 110.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|