C20H22N5O5S+ — CID 74513021
2-[(1,3-dimethyl-2,4-dioxo-6-propan-2-yl-4aH-pyrido[2,3-d]pyrimidin-1-ium-5-yl)sulfanyl]-N-(4-nitrophenyl)acetamide (PubChem CID 74513021) has the molecular formula C20H22N5O5S+ and a molecular weight of 444.49 g/mol. Its IUPAC name is 2-[(1,3-dimethyl-2,4-dioxo-6-propan-2-yl-4aH-pyrido[2,3-d]pyrimidin-1-ium-5-yl)sulfanyl]-N-(4-nitrophenyl)acetamide.
| Compound Name | 2-[(1,3-dimethyl-2,4-dioxo-6-propan-2-yl-4aH-pyrido[2,3-d]pyrimidin-1-ium-5-yl)sulfanyl]-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 74513021 |
| Molecular Formula | C20H22N5O5S+ |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 2-[(1,3-dimethyl-2,4-dioxo-6-propan-2-yl-4aH-pyrido[2,3-d]pyrimidin-1-ium-5-yl)sulfanyl]-N-(4-nitrophenyl)acetamide |
| SMILES | CC(C)C1=C(SCC(=O)Nc2ccc([N+](=O)[O-])cc2)C2C(=O)N(C)C(=O)[N+](C)=C2N=C1 |
| InChI | InChI=1S/C20H21N5O5S/c1-11(2)14-9-21-18-16(19(27)24(4)20(28)23(18)3)17(14)31-10-15(26)22-12-5-7-13(8-6-12)25(29)30/h5-9,11,16H,10H2,1-4H3/p+1 |
| InChIKey | VPAIXDVUHANVEN-UHFFFAOYSA-O |
| XLogP | 2.51 |
| TPSA | 124.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|