C22H27N5O3 — CID 7348191
(3S)-1-ethyl-3-[4-[6-(4-methoxyphenyl)-2-methylpyrimidin-4-yl]piperazin-1-yl]pyrrolidine-2,5-dione (PubChem CID 7348191) has the molecular formula C22H27N5O3 and a molecular weight of 409.49 g/mol. Its IUPAC name is (3S)-1-ethyl-3-[4-[6-(4-methoxyphenyl)-2-methylpyrimidin-4-yl]piperazin-1-yl]pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-ethyl-3-[4-[6-(4-methoxyphenyl)-2-methylpyrimidin-4-yl]piperazin-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7348191 |
| Molecular Formula | C22H27N5O3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | (3S)-1-ethyl-3-[4-[6-(4-methoxyphenyl)-2-methylpyrimidin-4-yl]piperazin-1-yl]pyrrolidine-2,5-dione |
| SMILES | CCN1C(=O)C[C@H](N2CCN(c3cc(-c4ccc(OC)cc4)nc(C)n3)CC2)C1=O |
| InChI | InChI=1S/C22H27N5O3/c1-4-27-21(28)14-19(22(27)29)25-9-11-26(12-10-25)20-13-18(23-15(2)24-20)16-5-7-17(30-3)8-6-16/h5-8,13,19H,4,9-12,14H2,1-3H3/t19-/m0/s1 |
| InChIKey | PEKVWGKMPKYCQH-IBGZPJMESA-N |
| XLogP | 1.73 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|