C16H23N5O2 — CID 7340873
(3R)-3-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]-1-ethylpyrrolidine-2,5-dione (PubChem CID 7340873) has the molecular formula C16H23N5O2 and a molecular weight of 317.39 g/mol. Its IUPAC name is (3R)-3-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]-1-ethylpyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]-1-ethylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7340873 |
| Molecular Formula | C16H23N5O2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | (3R)-3-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]-1-ethylpyrrolidine-2,5-dione |
| SMILES | CCN1C(=O)C[C@@H](N2CCN(c3nc(C)cc(C)n3)CC2)C1=O |
| InChI | InChI=1S/C16H23N5O2/c1-4-21-14(22)10-13(15(21)23)19-5-7-20(8-6-19)16-17-11(2)9-12(3)18-16/h9,13H,4-8,10H2,1-3H3/t13-/m1/s1 |
| InChIKey | ONAQCFPXMLAQNP-CYBMUJFWSA-N |
| XLogP | 0.36 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|