C12H22N2O — CID 7348729
(NZ)-N-[(2R,5R)-2-(dimethylamino)-2-methyl-5-prop-1-en-2-ylcyclohexylidene]hydroxylamine (PubChem CID 7348729) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is (NZ)-N-[(2R,5R)-2-(dimethylamino)-2-methyl-5-prop-1-en-2-ylcyclohexylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(2R,5R)-2-(dimethylamino)-2-methyl-5-prop-1-en-2-ylcyclohexylidene]hydroxylamine |
|---|---|
| PubChem CID | 7348729 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | (NZ)-N-[(2R,5R)-2-(dimethylamino)-2-methyl-5-prop-1-en-2-ylcyclohexylidene]hydroxylamine |
| SMILES | C=C(C)[C@@H]1CC[C@@](C)(N(C)C)/C(=N\O)C1 |
| InChI | InChI=1S/C12H22N2O/c1-9(2)10-6-7-12(3,14(4)5)11(8-10)13-15/h10,15H,1,6-8H2,2-5H3/b13-11-/t10-,12-/m1/s1 |
| InChIKey | HDYBOEKRMHUWEF-OEJLOUNASA-N |
| XLogP | 2.51 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|