C22H24N3O5+ — CID 7349311
2-[(2S)-3-[hydroxy-(4-methylphenyl)methylidene]-2-(3-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]ethyl-dimethylazanium (PubChem CID 7349311) has the molecular formula C22H24N3O5+ and a molecular weight of 410.45 g/mol. Its IUPAC name is 2-[(2S)-3-[hydroxy-(4-methylphenyl)methylidene]-2-(3-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]ethyl-dimethylazanium.
| Compound Name | 2-[(2S)-3-[hydroxy-(4-methylphenyl)methylidene]-2-(3-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 7349311 |
| Molecular Formula | C22H24N3O5+ |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 2-[(2S)-3-[hydroxy-(4-methylphenyl)methylidene]-2-(3-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]ethyl-dimethylazanium |
| SMILES | Cc1ccc(C(O)=C2C(=O)C(=O)N(CC[NH+](C)C)[C@H]2c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C22H23N3O5/c1-14-7-9-15(10-8-14)20(26)18-19(16-5-4-6-17(13-16)25(29)30)24(12-11-23(2)3)22(28)21(18)27/h4-10,13,19,26H,11-12H2,1-3H3/p+1/t19-/m0/s1 |
| InChIKey | MFZCDHIHSSWHCT-IBGZPJMESA-O |
| XLogP | 1.47 |
| TPSA | 105.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|