C6H2O4S-2 — CID 7349646
thiophene-2,3-dicarboxylate (PubChem CID 7349646) has the molecular formula C6H2O4S-2 and a molecular weight of 170.14 g/mol. Its IUPAC name is thiophene-2,3-dicarboxylate.
| Compound Name | thiophene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 7349646 |
| Molecular Formula | C6H2O4S-2 |
| Molecular Weight | 170.14 g/mol |
| Exact Mass | 169.97 |
| IUPAC Name | thiophene-2,3-dicarboxylate |
| SMILES | O=C([O-])c1ccsc1C(=O)[O-] |
| InChI | InChI=1S/C6H4O4S/c7-5(8)3-1-2-11-4(3)6(9)10/h1-2H,(H,7,8)(H,9,10)/p-2 |
| InChIKey | HIHKYDVSWLFRAY-UHFFFAOYSA-L |
| XLogP | -1.52 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.14 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |