C9H13NO3S — CID 28753765
3-[(1-hydroxy-2-methylpropan-2-yl)azaniumyl]thiophene-2-carboxylate (PubChem CID 28753765) has the molecular formula C9H13NO3S and a molecular weight of 215.27 g/mol. Its IUPAC name is 3-[(1-hydroxy-2-methylpropan-2-yl)azaniumyl]thiophene-2-carboxylate.
| Compound Name | 3-[(1-hydroxy-2-methylpropan-2-yl)azaniumyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 28753765 |
| Molecular Formula | C9H13NO3S |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 3-[(1-hydroxy-2-methylpropan-2-yl)azaniumyl]thiophene-2-carboxylate |
| SMILES | CC(C)(CO)[NH2+]c1ccsc1C(=O)[O-] |
| InChI | InChI=1S/C9H13NO3S/c1-9(2,5-11)10-6-3-4-14-7(6)8(12)13/h3-4,10-11H,5H2,1-2H3,(H,12,13) |
| InChIKey | VSBVOFXJVYNYLO-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |