About butyl (2S,4R)-2-propan-2-yl-1,3-thiazolidin-3-ium-4-carboxylate
butyl (2S,4R)-2-propan-2-yl-1,3-thiazolidin-3-ium-4-carboxylate (PubChem CID 7349840) has the molecular formula C11H22NO2S+
and a molecular weight of 232.37 g/mol. Its IUPAC name is butyl (2S,4R)-2-propan-2-yl-1,3-thiazolidin-3-ium-4-carboxylate.
Molecular Properties
| Compound Name | butyl (2S,4R)-2-propan-2-yl-1,3-thiazolidin-3-ium-4-carboxylate |
| PubChem CID | 7349840 |
| Molecular Formula | C11H22NO2S+ |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | butyl (2S,4R)-2-propan-2-yl-1,3-thiazolidin-3-ium-4-carboxylate |
| SMILES | CCCCOC(=O)[C@@H]1CS[C@@H](C(C)C)[NH2+]1 |
| InChI | InChI=1S/C11H21NO2S/c1-4-5-6-14-11(13)9-7-15-10(12-9)8(2)3/h8-10,12H,4-7H2,1-3H3/p+1/t9-,10-/m0/s1 |
| InChIKey | MWEQVMYTSFKMNG-UWVGGRQHSA-O |
| XLogP | 0.99 |
| TPSA | 42.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl (2S,4R)-2-propan-2-yl-1,3-thiazolidin-3-ium-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl (2S,4R)-2-propan-2-yl-1,3-thiazolidin-3-ium-4-carboxylate?
The IUPAC name of butyl (2S,4R)-2-propan-2-yl-1,3-thiazolidin-3-ium-4-carboxylate (CID 7349840) is butyl (2S,4R)-2-propan-2-yl-1,3-thiazolidin-3-ium-4-carboxylate.
What is the SMILES notation for butyl (2S,4R)-2-propan-2-yl-1,3-thiazolidin-3-ium-4-carboxylate?
The canonical SMILES for butyl (2S,4R)-2-propan-2-yl-1,3-thiazolidin-3-ium-4-carboxylate is CCCCOC(=O)[C@@H]1CS[C@@H](C(C)C)[NH2+]1.
What is the InChIKey of butyl (2S,4R)-2-propan-2-yl-1,3-thiazolidin-3-ium-4-carboxylate?
The InChIKey is MWEQVMYTSFKMNG-UWVGGRQHSA-O. The full InChI is InChI=1S/C11H21NO2S/c1-4-5-6-14-11(13)9-7-15-10(12-9)8(2)3/h8-10,12H,4-7H2,1-3H3/p+1/t9-,10-/m0/s1.
What are the key properties of butyl (2S,4R)-2-propan-2-yl-1,3-thiazolidin-3-ium-4-carboxylate?
butyl (2S,4R)-2-propan-2-yl-1,3-thiazolidin-3-ium-4-carboxylate has a molecular weight of 232.37 g/mol, XLogP of 0.99, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl (2S,4R)-2-propan-2-yl-1,3-thiazolidin-3-ium-4-carboxylate is sourced from PubChem (CID 7349840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).