C18H16ClFN6O2 — CID 7350370
2-[5-(2-chlorophenyl)tetrazol-2-yl]-N-[2-(4-fluoroanilino)-2-oxoethyl]-N-methylacetamide (PubChem CID 7350370) has the molecular formula C18H16ClFN6O2 and a molecular weight of 402.82 g/mol. Its IUPAC name is 2-[5-(2-chlorophenyl)tetrazol-2-yl]-N-[2-(4-fluoroanilino)-2-oxoethyl]-N-methylacetamide.
| Compound Name | 2-[5-(2-chlorophenyl)tetrazol-2-yl]-N-[2-(4-fluoroanilino)-2-oxoethyl]-N-methylacetamide |
|---|---|
| PubChem CID | 7350370 |
| Molecular Formula | C18H16ClFN6O2 |
| Molecular Weight | 402.82 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 2-[5-(2-chlorophenyl)tetrazol-2-yl]-N-[2-(4-fluoroanilino)-2-oxoethyl]-N-methylacetamide |
| SMILES | CN(CC(=O)Nc1ccc(F)cc1)C(=O)Cn1nnc(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C18H16ClFN6O2/c1-25(10-16(27)21-13-8-6-12(20)7-9-13)17(28)11-26-23-18(22-24-26)14-4-2-3-5-15(14)19/h2-9H,10-11H2,1H3,(H,21,27) |
| InChIKey | BHLHSUWTPCXSAS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.82 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |