C24H18N2O3S — CID 7354098
1-(4-methoxyphenyl)-5-[(5-naphthalen-1-yl-1,3,4-oxadiazol-2-yl)sulfanyl]pent-3-yn-1-one (PubChem CID 7354098) has the molecular formula C24H18N2O3S and a molecular weight of 414.49 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-5-[(5-naphthalen-1-yl-1,3,4-oxadiazol-2-yl)sulfanyl]pent-3-yn-1-one.
| Compound Name | 1-(4-methoxyphenyl)-5-[(5-naphthalen-1-yl-1,3,4-oxadiazol-2-yl)sulfanyl]pent-3-yn-1-one |
|---|---|
| PubChem CID | 7354098 |
| Molecular Formula | C24H18N2O3S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 1-(4-methoxyphenyl)-5-[(5-naphthalen-1-yl-1,3,4-oxadiazol-2-yl)sulfanyl]pent-3-yn-1-one |
| SMILES | COc1ccc(C(=O)CC#CCSc2nnc(-c3cccc4ccccc34)o2)cc1 |
| InChI | InChI=1S/C24H18N2O3S/c1-28-19-14-12-18(13-15-19)22(27)11-4-5-16-30-24-26-25-23(29-24)21-10-6-8-17-7-2-3-9-20(17)21/h2-3,6-10,12-15H,11,16H2,1H3 |
| InChIKey | WONSGZLNABABQT-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|