C15H15N3O3S2 — CID 91643320
N-[2-[(5-naphthalen-1-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethyl]methanesulfonamide (PubChem CID 91643320) has the molecular formula C15H15N3O3S2 and a molecular weight of 349.44 g/mol. Its IUPAC name is N-[2-[(5-naphthalen-1-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethyl]methanesulfonamide.
| Compound Name | N-[2-[(5-naphthalen-1-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 91643320 |
| Molecular Formula | C15H15N3O3S2 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | N-[2-[(5-naphthalen-1-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCSc1nnc(-c2cccc3ccccc23)o1 |
| InChI | InChI=1S/C15H15N3O3S2/c1-23(19,20)16-9-10-22-15-18-17-14(21-15)13-8-4-6-11-5-2-3-7-12(11)13/h2-8,16H,9-10H2,1H3 |
| InChIKey | DUXRULXVVBQYCK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|