C24H32N2O — CID 7358343
1-(4-methoxyphenyl)-N-[2-[(2S,4R,5S)-1,2,5-trimethyl-4-phenylpiperidin-4-yl]ethyl]methanimine (PubChem CID 7358343) has the molecular formula C24H32N2O and a molecular weight of 364.53 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-N-[2-[(2S,4R,5S)-1,2,5-trimethyl-4-phenylpiperidin-4-yl]ethyl]methanimine.
| Compound Name | 1-(4-methoxyphenyl)-N-[2-[(2S,4R,5S)-1,2,5-trimethyl-4-phenylpiperidin-4-yl]ethyl]methanimine |
|---|---|
| PubChem CID | 7358343 |
| Molecular Formula | C24H32N2O |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | 1-(4-methoxyphenyl)-N-[2-[(2S,4R,5S)-1,2,5-trimethyl-4-phenylpiperidin-4-yl]ethyl]methanimine |
| SMILES | COc1ccc(/C=N/CC[C@@]2(c3ccccc3)C[C@H](C)N(C)C[C@H]2C)cc1 |
| InChI | InChI=1S/C24H32N2O/c1-19-18-26(3)20(2)16-24(19,22-8-6-5-7-9-22)14-15-25-17-21-10-12-23(27-4)13-11-21/h5-13,17,19-20H,14-16,18H2,1-4H3/b25-17+/t19-,20+,24-/m1/s1 |
| InChIKey | XQZVHESVZCKBJB-GAOQUDRGSA-N |
| XLogP | 4.80 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|