C9H12N2O2S — CID 735917
1-methylsulfonyl-2,3-dihydroindol-5-amine (PubChem CID 735917) has the molecular formula C9H12N2O2S and a molecular weight of 212.27 g/mol. Its IUPAC name is 1-methylsulfonyl-2,3-dihydroindol-5-amine.
| Compound Name | 1-methylsulfonyl-2,3-dihydroindol-5-amine |
|---|---|
| PubChem CID | 735917 |
| Molecular Formula | C9H12N2O2S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 1-methylsulfonyl-2,3-dihydroindol-5-amine |
| SMILES | CS(=O)(=O)N1CCc2cc(N)ccc21 |
| InChI | InChI=1S/C9H12N2O2S/c1-14(12,13)11-5-4-7-6-8(10)2-3-9(7)11/h2-3,6H,4-5,10H2,1H3 |
| InChIKey | JLXKFJCABSSCPF-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|