C18H26N2O6S — CID 7360290
N-[[(2S)-3-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-2-hydroxypropyl]carbamothioyl]-4-methoxybenzamide (PubChem CID 7360290) has the molecular formula C18H26N2O6S and a molecular weight of 398.48 g/mol. Its IUPAC name is N-[[(2S)-3-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-2-hydroxypropyl]carbamothioyl]-4-methoxybenzamide.
| Compound Name | N-[[(2S)-3-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-2-hydroxypropyl]carbamothioyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 7360290 |
| Molecular Formula | C18H26N2O6S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | N-[[(2S)-3-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-2-hydroxypropyl]carbamothioyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(=S)NC[C@H](O)COC[C@H]2COC(C)(C)O2)cc1 |
| InChI | InChI=1S/C18H26N2O6S/c1-18(2)25-11-15(26-18)10-24-9-13(21)8-19-17(27)20-16(22)12-4-6-14(23-3)7-5-12/h4-7,13,15,21H,8-11H2,1-3H3,(H2,19,20,22,27)/t13-,15-/m0/s1 |
| InChIKey | HYBWPICGMPEYOI-ZFWWWQNUSA-N |
| XLogP | 0.83 |
| TPSA | 98.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|