C18H31N2O2+ — CID 7369965
cyclohexyl-[3-[(4,4-dimethyl-2,6-dioxocyclohexyl)methylideneamino]propyl]azanium (PubChem CID 7369965) has the molecular formula C18H31N2O2+ and a molecular weight of 307.46 g/mol. Its IUPAC name is cyclohexyl-[3-[(4,4-dimethyl-2,6-dioxocyclohexyl)methylideneamino]propyl]azanium.
| Compound Name | cyclohexyl-[3-[(4,4-dimethyl-2,6-dioxocyclohexyl)methylideneamino]propyl]azanium |
|---|---|
| PubChem CID | 7369965 |
| Molecular Formula | C18H31N2O2+ |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.24 |
| IUPAC Name | cyclohexyl-[3-[(4,4-dimethyl-2,6-dioxocyclohexyl)methylideneamino]propyl]azanium |
| SMILES | CC1(C)CC(=O)C(/C=N/CCC[NH2+]C2CCCCC2)C(=O)C1 |
| InChI | InChI=1S/C18H30N2O2/c1-18(2)11-16(21)15(17(22)12-18)13-19-9-6-10-20-14-7-4-3-5-8-14/h13-15,20H,3-12H2,1-2H3/p+1/b19-13+ |
| InChIKey | ZSTFPTCWHHIUDE-CPNJWEJPSA-O |
| XLogP | 1.92 |
| TPSA | 63.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|