C17H28N3O3+ — CID 7072615
2-[2-(4-acetylpiperazin-1-ium-1-yl)ethyliminomethyl]-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 7072615) has the molecular formula C17H28N3O3+ and a molecular weight of 322.43 g/mol. Its IUPAC name is 2-[2-(4-acetylpiperazin-1-ium-1-yl)ethyliminomethyl]-5,5-dimethylcyclohexane-1,3-dione.
| Compound Name | 2-[2-(4-acetylpiperazin-1-ium-1-yl)ethyliminomethyl]-5,5-dimethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 7072615 |
| Molecular Formula | C17H28N3O3+ |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 2-[2-(4-acetylpiperazin-1-ium-1-yl)ethyliminomethyl]-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | CC(=O)N1CC[NH+](CC/N=C/C2C(=O)CC(C)(C)CC2=O)CC1 |
| InChI | InChI=1S/C17H27N3O3/c1-13(21)20-8-6-19(7-9-20)5-4-18-12-14-15(22)10-17(2,3)11-16(14)23/h12,14H,4-11H2,1-3H3/p+1/b18-12+ |
| InChIKey | JIZRDXGIBALUML-LDADJPATSA-O |
| XLogP | -0.62 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|