C14H9FN4O5S — CID 7373983
N-(4-fluoro-2-nitrophenyl)-2-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide (PubChem CID 7373983) has the molecular formula C14H9FN4O5S and a molecular weight of 364.31 g/mol. Its IUPAC name is N-(4-fluoro-2-nitrophenyl)-2-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(4-fluoro-2-nitrophenyl)-2-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 7373983 |
| Molecular Formula | C14H9FN4O5S |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | N-(4-fluoro-2-nitrophenyl)-2-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
| SMILES | O=C(CSc1nnc(-c2ccco2)o1)Nc1ccc(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H9FN4O5S/c15-8-3-4-9(10(6-8)19(21)22)16-12(20)7-25-14-18-17-13(24-14)11-2-1-5-23-11/h1-6H,7H2,(H,16,20) |
| InChIKey | KZJDIGCYZXXQBN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 124.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|