C22H28F2N4O2+2 — CID 7384941
N'-(2,5-difluorophenyl)-N-[(2R)-2-(4-methylphenyl)-2-(4-methylpiperazine-1,4-diium-1-yl)ethyl]oxamide (PubChem CID 7384941) has the molecular formula C22H28F2N4O2+2 and a molecular weight of 418.49 g/mol. Its IUPAC name is N'-(2,5-difluorophenyl)-N-[(2R)-2-(4-methylphenyl)-2-(4-methylpiperazine-1,4-diium-1-yl)ethyl]oxamide.
| Compound Name | N'-(2,5-difluorophenyl)-N-[(2R)-2-(4-methylphenyl)-2-(4-methylpiperazine-1,4-diium-1-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 7384941 |
| Molecular Formula | C22H28F2N4O2+2 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | N'-(2,5-difluorophenyl)-N-[(2R)-2-(4-methylphenyl)-2-(4-methylpiperazine-1,4-diium-1-yl)ethyl]oxamide |
| SMILES | Cc1ccc([C@H](CNC(=O)C(=O)Nc2cc(F)ccc2F)[NH+]2CC[NH+](C)CC2)cc1 |
| InChI | InChI=1S/C22H26F2N4O2/c1-15-3-5-16(6-4-15)20(28-11-9-27(2)10-12-28)14-25-21(29)22(30)26-19-13-17(23)7-8-18(19)24/h3-8,13,20H,9-12,14H2,1-2H3,(H,25,29)(H,26,30)/p+2/t20-/m0/s1 |
| InChIKey | OUMUYJSRGFRBRU-FQEVSTJZSA-P |
| XLogP | -0.52 |
| TPSA | 67.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|