C19H20F3N2O2+ — CID 7393141
(2R)-2-morpholin-4-ium-4-yl-2-phenyl-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 7393141) has the molecular formula C19H20F3N2O2+ and a molecular weight of 365.38 g/mol. Its IUPAC name is (2R)-2-morpholin-4-ium-4-yl-2-phenyl-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | (2R)-2-morpholin-4-ium-4-yl-2-phenyl-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 7393141 |
| Molecular Formula | C19H20F3N2O2+ |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | (2R)-2-morpholin-4-ium-4-yl-2-phenyl-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)[C@@H](c1ccccc1)[NH+]1CCOCC1 |
| InChI | InChI=1S/C19H19F3N2O2/c20-19(21,22)15-7-4-8-16(13-15)23-18(25)17(14-5-2-1-3-6-14)24-9-11-26-12-10-24/h1-8,13,17H,9-12H2,(H,23,25)/p+1/t17-/m1/s1 |
| InChIKey | AHTOFCASOPSGJS-QGZVFWFLSA-O |
| XLogP | 2.30 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |