C14H13NO7 — CID 7395520
[2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 2,3-dihydro-1,4-dioxine-5-carboxylate (PubChem CID 7395520) has the molecular formula C14H13NO7 and a molecular weight of 307.26 g/mol. Its IUPAC name is [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 2,3-dihydro-1,4-dioxine-5-carboxylate.
| Compound Name | [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 2,3-dihydro-1,4-dioxine-5-carboxylate |
|---|---|
| PubChem CID | 7395520 |
| Molecular Formula | C14H13NO7 |
| Molecular Weight | 307.26 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | [2-(4-methyl-3-nitrophenyl)-2-oxoethyl] 2,3-dihydro-1,4-dioxine-5-carboxylate |
| SMILES | Cc1ccc(C(=O)COC(=O)C2=COCCO2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H13NO7/c1-9-2-3-10(6-11(9)15(18)19)12(16)7-22-14(17)13-8-20-4-5-21-13/h2-3,6,8H,4-5,7H2,1H3 |
| InChIKey | HFDLZTFSSTYZJR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.26 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|