C17H13Cl3N2O — CID 7395831
3-chloro-N-[(Z)-[(1S,3R)-2,2-dichloro-3-phenylcyclopropyl]methylideneamino]benzamide (PubChem CID 7395831) has the molecular formula C17H13Cl3N2O and a molecular weight of 367.66 g/mol. Its IUPAC name is 3-chloro-N-[(Z)-[(1S,3R)-2,2-dichloro-3-phenylcyclopropyl]methylideneamino]benzamide.
| Compound Name | 3-chloro-N-[(Z)-[(1S,3R)-2,2-dichloro-3-phenylcyclopropyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 7395831 |
| Molecular Formula | C17H13Cl3N2O |
| Molecular Weight | 367.66 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | 3-chloro-N-[(Z)-[(1S,3R)-2,2-dichloro-3-phenylcyclopropyl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C\[C@@H]1[C@H](c2ccccc2)C1(Cl)Cl)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H13Cl3N2O/c18-13-8-4-7-12(9-13)16(23)22-21-10-14-15(17(14,19)20)11-5-2-1-3-6-11/h1-10,14-15H,(H,22,23)/b21-10-/t14-,15+/m1/s1 |
| InChIKey | IQRUVJSXEYRMEC-RNVQKBRISA-N |
| XLogP | 4.64 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.66 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|