C18H22N2O3S2 — CID 7398859
N-(4-ethylphenyl)-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide (PubChem CID 7398859) has the molecular formula C18H22N2O3S2 and a molecular weight of 378.52 g/mol. Its IUPAC name is N-(4-ethylphenyl)-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-(4-ethylphenyl)-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 7398859 |
| Molecular Formula | C18H22N2O3S2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | N-(4-ethylphenyl)-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide |
| SMILES | CCc1ccc(NC(=O)C2CCN(S(=O)(=O)c3cccs3)CC2)cc1 |
| InChI | InChI=1S/C18H22N2O3S2/c1-2-14-5-7-16(8-6-14)19-18(21)15-9-11-20(12-10-15)25(22,23)17-4-3-13-24-17/h3-8,13,15H,2,9-12H2,1H3,(H,19,21) |
| InChIKey | YDXDAPSGESSJLX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |