About 1-(3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)ethanone
1-(3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)ethanone (PubChem CID 74030676) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is 1-(3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)ethanone.
Molecular Properties
| Compound Name | 1-(3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)ethanone |
| PubChem CID | 74030676 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 1-(3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)ethanone |
| SMILES | CC(=O)C1=C(O)C2(C)CCC1C2(C)C |
| InChI | InChI=1S/C12H18O2/c1-7(13)9-8-5-6-12(4,10(9)14)11(8,2)3/h8,14H,5-6H2,1-4H3 |
| InChIKey | POLVUNNEBBFDAH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)ethanone?
The IUPAC name of 1-(3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)ethanone (CID 74030676) is 1-(3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)ethanone.
What is the SMILES notation for 1-(3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)ethanone?
The canonical SMILES for 1-(3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)ethanone is CC(=O)C1=C(O)C2(C)CCC1C2(C)C.
What is the InChIKey of 1-(3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)ethanone?
The InChIKey is POLVUNNEBBFDAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O2/c1-7(13)9-8-5-6-12(4,10(9)14)11(8,2)3/h8,14H,5-6H2,1-4H3.
What are the key properties of 1-(3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)ethanone?
1-(3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)ethanone has a molecular weight of 194.27 g/mol, XLogP of 2.84, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)ethanone is sourced from PubChem (CID 74030676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).