C9H12N2O4 — CID 740354
ethyl 2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetate (PubChem CID 740354) has the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. Its IUPAC name is ethyl 2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetate.
| Compound Name | ethyl 2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetate |
|---|---|
| PubChem CID | 740354 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | ethyl 2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetate |
| SMILES | CCOC(=O)Cc1c(C)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H12N2O4/c1-3-15-7(12)4-6-5(2)10-9(14)11-8(6)13/h3-4H2,1-2H3,(H2,10,11,13,14) |
| InChIKey | CHMASNSWTSSDCU-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |