C12H14N2O8S — CID 74046100
5-butan-2-yl-2-(2-hydroperoxyethenylsulfonyl)-1,3-dinitrobenzene (PubChem CID 74046100) has the molecular formula C12H14N2O8S and a molecular weight of 346.32 g/mol. Its IUPAC name is 5-butan-2-yl-2-(2-hydroperoxyethenylsulfonyl)-1,3-dinitrobenzene.
| Compound Name | 5-butan-2-yl-2-(2-hydroperoxyethenylsulfonyl)-1,3-dinitrobenzene |
|---|---|
| PubChem CID | 74046100 |
| Molecular Formula | C12H14N2O8S |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 5-butan-2-yl-2-(2-hydroperoxyethenylsulfonyl)-1,3-dinitrobenzene |
| SMILES | CCC(C)c1cc([N+](=O)[O-])c(S(=O)(=O)C=COO)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H14N2O8S/c1-3-8(2)9-6-10(13(15)16)12(11(7-9)14(17)18)23(20,21)5-4-22-19/h4-8,19H,3H2,1-2H3 |
| InChIKey | NNUNZRXFTXBLKF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 149.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|