C20H33ClO — CID 74051500
4-chloro-1-(6,10-dimethyl-2-methylidene-10-bicyclo[7.2.0]undec-5-enyl)-4-methylpentan-3-ol (PubChem CID 74051500) has the molecular formula C20H33ClO and a molecular weight of 324.94 g/mol. Its IUPAC name is 4-chloro-1-(6,10-dimethyl-2-methylidene-10-bicyclo[7.2.0]undec-5-enyl)-4-methylpentan-3-ol.
| Compound Name | 4-chloro-1-(6,10-dimethyl-2-methylidene-10-bicyclo[7.2.0]undec-5-enyl)-4-methylpentan-3-ol |
|---|---|
| PubChem CID | 74051500 |
| Molecular Formula | C20H33ClO |
| Molecular Weight | 324.94 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | 4-chloro-1-(6,10-dimethyl-2-methylidene-10-bicyclo[7.2.0]undec-5-enyl)-4-methylpentan-3-ol |
| SMILES | C=C1CCC=C(C)CCC2C1CC2(C)CCC(O)C(C)(C)Cl |
| InChI | InChI=1S/C20H33ClO/c1-14-7-6-8-15(2)16-13-20(5,17(16)10-9-14)12-11-18(22)19(3,4)21/h7,16-18,22H,2,6,8-13H2,1,3-5H3 |
| InChIKey | MOARSUKXBXQYKA-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.94 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|