C25H36O4 — CID 74052807
(2-methyl-4-octadeca-3,6,9,12,15-pentaenyl-5-oxooxolan-3-yl) acetate (PubChem CID 74052807) has the molecular formula C25H36O4 and a molecular weight of 400.56 g/mol. Its IUPAC name is (2-methyl-4-octadeca-3,6,9,12,15-pentaenyl-5-oxooxolan-3-yl) acetate.
| Compound Name | (2-methyl-4-octadeca-3,6,9,12,15-pentaenyl-5-oxooxolan-3-yl) acetate |
|---|---|
| PubChem CID | 74052807 |
| Molecular Formula | C25H36O4 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | (2-methyl-4-octadeca-3,6,9,12,15-pentaenyl-5-oxooxolan-3-yl) acetate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCC1C(=O)OC(C)C1OC(C)=O |
| InChI | InChI=1S/C25H36O4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23-24(29-22(3)26)21(2)28-25(23)27/h5-6,8-9,11-12,14-15,17-18,21,23-24H,4,7,10,13,16,19-20H2,1-3H3 |
| InChIKey | LFCWALIIPYISGL-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|