C29H40O4 — CID 67724060
(2-ethyl-5-methyl-4-oxofuran-3-yl) docosa-4,7,10,13,16,19-hexaenoate (PubChem CID 67724060) has the molecular formula C29H40O4 and a molecular weight of 452.64 g/mol. Its IUPAC name is (2-ethyl-5-methyl-4-oxofuran-3-yl) docosa-4,7,10,13,16,19-hexaenoate.
| Compound Name | (2-ethyl-5-methyl-4-oxofuran-3-yl) docosa-4,7,10,13,16,19-hexaenoate |
|---|---|
| PubChem CID | 67724060 |
| Molecular Formula | C29H40O4 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | (2-ethyl-5-methyl-4-oxofuran-3-yl) docosa-4,7,10,13,16,19-hexaenoate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC1=C(CC)OC(C)C1=O |
| InChI | InChI=1S/C29H40O4/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-27(30)33-29-26(5-2)32-25(3)28(29)31/h6-7,9-10,12-13,15-16,18-19,21-22,25H,4-5,8,11,14,17,20,23-24H2,1-3H3 |
| InChIKey | LOAFGCXDTPBNFB-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|