C19H24N4O6S — CID 74054381
4-(dimethylamino)-N'-[2-(4-nitrophenyl)ethenyl]benzenecarboximidamide;2-hydroxyethanesulfonic acid (PubChem CID 74054381) has the molecular formula C19H24N4O6S and a molecular weight of 436.49 g/mol. Its IUPAC name is 4-(dimethylamino)-N'-[2-(4-nitrophenyl)ethenyl]benzenecarboximidamide;2-hydroxyethanesulfonic acid.
| Compound Name | 4-(dimethylamino)-N'-[2-(4-nitrophenyl)ethenyl]benzenecarboximidamide;2-hydroxyethanesulfonic acid |
|---|---|
| PubChem CID | 74054381 |
| Molecular Formula | C19H24N4O6S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 4-(dimethylamino)-N'-[2-(4-nitrophenyl)ethenyl]benzenecarboximidamide;2-hydroxyethanesulfonic acid |
| SMILES | CN(C)c1ccc(/C(N)=N/C=Cc2ccc([N+](=O)[O-])cc2)cc1.O=S(=O)(O)CCO |
| InChI | InChI=1S/C17H18N4O2.C2H6O4S/c1-20(2)15-9-5-14(6-10-15)17(18)19-12-11-13-3-7-16(8-4-13)21(22)23;3-1-2-7(4,5)6/h3-12H,1-2H3,(H2,18,19);3H,1-2H2,(H,4,5,6) |
| InChIKey | ORPGFXOKRJNTCD-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 159.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|