C40H38N3O4S3+ — CID 74059439
4-[2-[[7-[(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-4,4-dimethyl-1-benzofuran-5-ylidene]methyl]-5-indol-1-yl-1,3-benzothiazol-3-ium-3-yl]butane-1-sulfonic acid (PubChem CID 74059439) has the molecular formula C40H38N3O4S3+ and a molecular weight of 720.96 g/mol. Its IUPAC name is 4-[2-[[7-[(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-4,4-dimethyl-1-benzofuran-5-ylidene]methyl]-5-indol-1-yl-1,3-benzothiazol-3-ium-3-yl]butane-1-sulfonic acid.
| Compound Name | 4-[2-[[7-[(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-4,4-dimethyl-1-benzofuran-5-ylidene]methyl]-5-indol-1-yl-1,3-benzothiazol-3-ium-3-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 74059439 |
| Molecular Formula | C40H38N3O4S3+ |
| Molecular Weight | 720.96 g/mol |
| Exact Mass | 720.20 |
| IUPAC Name | 4-[2-[[7-[(3-ethyl-1,3-benzothiazol-2-ylidene)methyl]-4,4-dimethyl-1-benzofuran-5-ylidene]methyl]-5-indol-1-yl-1,3-benzothiazol-3-ium-3-yl]butane-1-sulfonic acid |
| SMILES | CCN1C(=CC2=CC(=Cc3sc4ccc(-n5ccc6ccccc65)cc4[n+]3CCCCS(=O)(=O)O)C(C)(C)c3ccoc32)Sc2ccccc21 |
| InChI | InChI=1S/C40H37N3O4S3/c1-4-41-33-13-7-8-14-35(33)48-37(41)24-28-23-29(40(2,3)31-18-21-47-39(28)31)25-38-43(19-9-10-22-50(44,45)46)34-26-30(15-16-36(34)49-38)42-20-17-27-11-5-6-12-32(27)42/h5-8,11-18,20-21,23-26H,4,9-10,19,22H2,1-3H3/p+1 |
| InChIKey | MDADXFIDVSJYGH-UHFFFAOYSA-O |
| XLogP | 9.63 |
| TPSA | 79.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.96 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|