C31H26N3O7S4- — CID 20600342
3-[(2Z)-5-indol-1-yl-2-[[1-(3-sulfonatopropyl)furo[3,2-e][1,3]benzothiazol-1-ium-2-yl]methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonate (PubChem CID 20600342) has the molecular formula C31H26N3O7S4- and a molecular weight of 680.83 g/mol. Its IUPAC name is 3-[(2Z)-5-indol-1-yl-2-[[1-(3-sulfonatopropyl)furo[3,2-e][1,3]benzothiazol-1-ium-2-yl]methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonate.
| Compound Name | 3-[(2Z)-5-indol-1-yl-2-[[1-(3-sulfonatopropyl)furo[3,2-e][1,3]benzothiazol-1-ium-2-yl]methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 20600342 |
| Molecular Formula | C31H26N3O7S4- |
| Molecular Weight | 680.83 g/mol |
| Exact Mass | 680.07 |
| IUPAC Name | 3-[(2Z)-5-indol-1-yl-2-[[1-(3-sulfonatopropyl)furo[3,2-e][1,3]benzothiazol-1-ium-2-yl]methylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonate |
| SMILES | O=S(=O)([O-])CCCN1/C(=C/c2sc3ccc4occc4c3[n+]2CCCS(=O)(=O)[O-])Sc2ccc(-n3ccc4ccccc43)cc21 |
| InChI | InChI=1S/C31H27N3O7S4/c35-44(36,37)17-3-13-33-25-19-22(32-15-11-21-5-1-2-6-24(21)32)7-9-27(25)42-29(33)20-30-34(14-4-18-45(38,39)40)31-23-12-16-41-26(23)8-10-28(31)43-30/h1-2,5-12,15-16,19-20H,3-4,13-14,17-18H2,(H-,35,36,37,38,39,40)/p-1 |
| InChIKey | WSXPZTXDXCHLFL-UHFFFAOYSA-M |
| XLogP | 5.66 |
| TPSA | 139.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.83 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|