C40H50ClN2O4+ — CID 74064157
[2-[2-[2-chloro-3-[2-[1-ethyl-5-(methoxymethoxy)-3,3,6-trimethylindol-2-ylidene]ethylidene]cyclohexen-1-yl]ethenyl]-1-ethyl-3,3,6-trimethylindol-1-ium-5-yl] acetate (PubChem CID 74064157) has the molecular formula C40H50ClN2O4+ and a molecular weight of 658.30 g/mol. Its IUPAC name is [2-[2-[2-chloro-3-[2-[1-ethyl-5-(methoxymethoxy)-3,3,6-trimethylindol-2-ylidene]ethylidene]cyclohexen-1-yl]ethenyl]-1-ethyl-3,3,6-trimethylindol-1-ium-5-yl] acetate.
| Compound Name | [2-[2-[2-chloro-3-[2-[1-ethyl-5-(methoxymethoxy)-3,3,6-trimethylindol-2-ylidene]ethylidene]cyclohexen-1-yl]ethenyl]-1-ethyl-3,3,6-trimethylindol-1-ium-5-yl] acetate |
|---|---|
| PubChem CID | 74064157 |
| Molecular Formula | C40H50ClN2O4+ |
| Molecular Weight | 658.30 g/mol |
| Exact Mass | 657.35 |
| IUPAC Name | [2-[2-[2-chloro-3-[2-[1-ethyl-5-(methoxymethoxy)-3,3,6-trimethylindol-2-ylidene]ethylidene]cyclohexen-1-yl]ethenyl]-1-ethyl-3,3,6-trimethylindol-1-ium-5-yl] acetate |
| SMILES | CCN1C(=CC=C2CCCC(C=CC3=[N+](CC)c4cc(C)c(OC(C)=O)cc4C3(C)C)=C2Cl)C(C)(C)c2cc(OCOC)c(C)cc21 |
| InChI | InChI=1S/C40H50ClN2O4/c1-11-42-32-20-25(3)34(46-24-45-10)22-30(32)39(6,7)36(42)18-16-28-14-13-15-29(38(28)41)17-19-37-40(8,9)31-23-35(47-27(5)44)26(4)21-33(31)43(37)12-2/h16-23H,11-15,24H2,1-10H3/q+1 |
| InChIKey | SOUUQJOYMDMWTC-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 51.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.30 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|