C35H50O10 — CID 74071739
[5,6,11-trihydroxy-4-(hydroxymethyl)-8,12,15,15-tetramethyl-14-(2-methylbutanoyloxy)-7-oxo-3-oxapentacyclo[9.5.0.02,4.06,10.014,16]hexadec-8-en-13-yl] deca-2,4-dienoate (PubChem CID 74071739) has the molecular formula C35H50O10 and a molecular weight of 630.78 g/mol. Its IUPAC name is [5,6,11-trihydroxy-4-(hydroxymethyl)-8,12,15,15-tetramethyl-14-(2-methylbutanoyloxy)-7-oxo-3-oxapentacyclo[9.5.0.02,4.06,10.014,16]hexadec-8-en-13-yl] deca-2,4-dienoate.
| Compound Name | [5,6,11-trihydroxy-4-(hydroxymethyl)-8,12,15,15-tetramethyl-14-(2-methylbutanoyloxy)-7-oxo-3-oxapentacyclo[9.5.0.02,4.06,10.014,16]hexadec-8-en-13-yl] deca-2,4-dienoate |
|---|---|
| PubChem CID | 74071739 |
| Molecular Formula | C35H50O10 |
| Molecular Weight | 630.78 g/mol |
| Exact Mass | 630.34 |
| IUPAC Name | [5,6,11-trihydroxy-4-(hydroxymethyl)-8,12,15,15-tetramethyl-14-(2-methylbutanoyloxy)-7-oxo-3-oxapentacyclo[9.5.0.02,4.06,10.014,16]hexadec-8-en-13-yl] deca-2,4-dienoate |
| SMILES | CCCCCC=CC=CC(=O)OC1C(C)C2(O)C(C3OC3(CO)C(O)C3(O)C(=O)C(C)=CC32)C2C(C)(C)C12OC(=O)C(C)CC |
| InChI | InChI=1S/C35H50O10/c1-8-10-11-12-13-14-15-16-23(37)43-27-21(5)33(41)22-17-20(4)26(38)34(22,42)30(40)32(18-36)28(44-32)24(33)25-31(6,7)35(25,27)45-29(39)19(3)9-2/h13-17,19,21-22,24-25,27-28,30,36,40-42H,8-12,18H2,1-7H3 |
| InChIKey | KKAOYUIAIHMKIQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 163.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.78 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|