C5H9NO6S — CID 74083845
[(1-methoxy-1-oxopropan-2-yl)amino]-oxomethanesulfonic acid (PubChem CID 74083845) has the molecular formula C5H9NO6S and a molecular weight of 211.19 g/mol. Its IUPAC name is [(1-methoxy-1-oxopropan-2-yl)amino]-oxomethanesulfonic acid.
| Compound Name | [(1-methoxy-1-oxopropan-2-yl)amino]-oxomethanesulfonic acid |
|---|---|
| PubChem CID | 74083845 |
| Molecular Formula | C5H9NO6S |
| Molecular Weight | 211.19 g/mol |
| Exact Mass | 211.02 |
| IUPAC Name | [(1-methoxy-1-oxopropan-2-yl)amino]-oxomethanesulfonic acid |
| SMILES | COC(=O)C(C)NC(=O)S(=O)(=O)O |
| InChI | InChI=1S/C5H9NO6S/c1-3(4(7)12-2)6-5(8)13(9,10)11/h3H,1-2H3,(H,6,8)(H,9,10,11) |
| InChIKey | QVHBXTSPFMZGGN-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.19 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|