C18H24N3O2S+ — CID 7410424
1-(azepan-1-yl)-2-[(3R)-3-hydroxy-3,4-dihydro-2H-[1,3]thiazino[2,3-b]benzimidazol-5-ium-10-yl]ethanone (PubChem CID 7410424) has the molecular formula C18H24N3O2S+ and a molecular weight of 346.48 g/mol. Its IUPAC name is 1-(azepan-1-yl)-2-[(3R)-3-hydroxy-3,4-dihydro-2H-[1,3]thiazino[2,3-b]benzimidazol-5-ium-10-yl]ethanone.
| Compound Name | 1-(azepan-1-yl)-2-[(3R)-3-hydroxy-3,4-dihydro-2H-[1,3]thiazino[2,3-b]benzimidazol-5-ium-10-yl]ethanone |
|---|---|
| PubChem CID | 7410424 |
| Molecular Formula | C18H24N3O2S+ |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 1-(azepan-1-yl)-2-[(3R)-3-hydroxy-3,4-dihydro-2H-[1,3]thiazino[2,3-b]benzimidazol-5-ium-10-yl]ethanone |
| SMILES | O=C(Cn1c2[n+](c3ccccc31)C[C@@H](O)CS2)N1CCCCCC1 |
| InChI | InChI=1S/C18H24N3O2S/c22-14-11-20-15-7-3-4-8-16(15)21(18(20)24-13-14)12-17(23)19-9-5-1-2-6-10-19/h3-4,7-8,14,22H,1-2,5-6,9-13H2/q+1/t14-/m1/s1 |
| InChIKey | YWMGHIHSRYGMCO-CQSZACIVSA-N |
| XLogP | 1.80 |
| TPSA | 49.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|