C17H16BrN2S+ — CID 4577823
10-benzyl-3-bromo-3,4-dihydro-2H-[1,3]thiazino[3,2-a]benzimidazol-5-ium (PubChem CID 4577823) has the molecular formula C17H16BrN2S+ and a molecular weight of 360.30 g/mol. Its IUPAC name is 10-benzyl-3-bromo-3,4-dihydro-2H-[1,3]thiazino[3,2-a]benzimidazol-5-ium.
| Compound Name | 10-benzyl-3-bromo-3,4-dihydro-2H-[1,3]thiazino[3,2-a]benzimidazol-5-ium |
|---|---|
| PubChem CID | 4577823 |
| Molecular Formula | C17H16BrN2S+ |
| Molecular Weight | 360.30 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | 10-benzyl-3-bromo-3,4-dihydro-2H-[1,3]thiazino[3,2-a]benzimidazol-5-ium |
| SMILES | BrC1CSc2n(Cc3ccccc3)c3ccccc3[n+]2C1 |
| InChI | InChI=1S/C17H16BrN2S/c18-14-11-20-16-9-5-4-8-15(16)19(17(20)21-12-14)10-13-6-2-1-3-7-13/h1-9,14H,10-12H2/q+1 |
| InChIKey | VPCCNKQDDMJXRN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|