C8H12O3 — CID 74109572
3-(1-hydroxyethyl)-2-methyl-2,5-dihydropyran-6-one (PubChem CID 74109572) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is 3-(1-hydroxyethyl)-2-methyl-2,5-dihydropyran-6-one.
| Compound Name | 3-(1-hydroxyethyl)-2-methyl-2,5-dihydropyran-6-one |
|---|---|
| PubChem CID | 74109572 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 3-(1-hydroxyethyl)-2-methyl-2,5-dihydropyran-6-one |
| SMILES | CC(O)C1=CCC(=O)OC1C |
| InChI | InChI=1S/C8H12O3/c1-5(9)7-3-4-8(10)11-6(7)2/h3,5-6,9H,4H2,1-2H3 |
| InChIKey | BKLHBZPYOGCXSX-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|