C9H14O2 — CID 101003542
(5Z)-2,5-dimethyl-2,3,4,7-tetrahydrooxocin-8-one (PubChem CID 101003542) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is (5Z)-2,5-dimethyl-2,3,4,7-tetrahydrooxocin-8-one.
| Compound Name | (5Z)-2,5-dimethyl-2,3,4,7-tetrahydrooxocin-8-one |
|---|---|
| PubChem CID | 101003542 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | (5Z)-2,5-dimethyl-2,3,4,7-tetrahydrooxocin-8-one |
| SMILES | C/C1=C/CC(=O)OC(C)CC1 |
| InChI | InChI=1S/C9H14O2/c1-7-3-5-8(2)11-9(10)6-4-7/h4,8H,3,5-6H2,1-2H3/b7-4- |
| InChIKey | GPEBBFMVRGNGOR-DAXSKMNVSA-N |
| XLogP | 2.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|