C32H42O5 — CID 74111182
2-[8-(3-ethoxy-3-methylbutyl)-2,2-dimethyl-3,4-dihydrochromen-6-yl]-8,8-dimethyl-2,3,9,10-tetrahydropyrano[2,3-h]chromen-4-one (PubChem CID 74111182) has the molecular formula C32H42O5 and a molecular weight of 506.68 g/mol. Its IUPAC name is 2-[8-(3-ethoxy-3-methylbutyl)-2,2-dimethyl-3,4-dihydrochromen-6-yl]-8,8-dimethyl-2,3,9,10-tetrahydropyrano[2,3-h]chromen-4-one.
| Compound Name | 2-[8-(3-ethoxy-3-methylbutyl)-2,2-dimethyl-3,4-dihydrochromen-6-yl]-8,8-dimethyl-2,3,9,10-tetrahydropyrano[2,3-h]chromen-4-one |
|---|---|
| PubChem CID | 74111182 |
| Molecular Formula | C32H42O5 |
| Molecular Weight | 506.68 g/mol |
| Exact Mass | 506.30 |
| IUPAC Name | 2-[8-(3-ethoxy-3-methylbutyl)-2,2-dimethyl-3,4-dihydrochromen-6-yl]-8,8-dimethyl-2,3,9,10-tetrahydropyrano[2,3-h]chromen-4-one |
| SMILES | CCOC(C)(C)CCc1cc(C2CC(=O)c3ccc4c(c3O2)CCC(C)(C)O4)cc2c1OC(C)(C)CC2 |
| InChI | InChI=1S/C32H42O5/c1-8-34-30(2,3)14-11-20-17-22(18-21-12-15-32(6,7)37-28(20)21)27-19-25(33)23-9-10-26-24(29(23)35-27)13-16-31(4,5)36-26/h9-10,17-18,27H,8,11-16,19H2,1-7H3 |
| InChIKey | UNATUDWGINZOAN-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.68 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |