About benzoyl chloride
benzoyl chloride (PubChem CID 7412) has the molecular formula C7H5ClO
and a molecular weight of 140.57 g/mol. Its IUPAC name is benzoyl chloride.
Molecular Properties
| Compound Name | benzoyl chloride |
| PubChem CID | 7412 |
| Molecular Formula | C7H5ClO |
| Molecular Weight | 140.57 g/mol |
| Exact Mass | 140.00 |
| IUPAC Name | benzoyl chloride |
| SMILES | O=C(Cl)c1ccccc1 |
| InChI | InChI=1S/C7H5ClO/c8-7(9)6-4-2-1-3-5-6/h1-5H |
| InChIKey | PASDCCFISLVPSO-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.57 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze benzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoyl chloride?
The IUPAC name of benzoyl chloride (CID 7412) is benzoyl chloride.
What is the SMILES notation for benzoyl chloride?
The canonical SMILES for benzoyl chloride is O=C(Cl)c1ccccc1.
What is the InChIKey of benzoyl chloride?
The InChIKey is PASDCCFISLVPSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClO/c8-7(9)6-4-2-1-3-5-6/h1-5H.
What are the key properties of benzoyl chloride?
benzoyl chloride has a molecular weight of 140.57 g/mol, XLogP of 2.07, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzoyl chloride is sourced from PubChem (CID 7412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).